17-AEP-GA structure
|
Common Name | 17-AEP-GA | ||
|---|---|---|---|---|
| CAS Number | 75747-23-8 | Molecular Weight | 642.78 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H50N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 17-AEP-GA17-AEP-GA, an HSP90 antagonist, is a potent inhibitor of glioblastoma cell proliferation, survival, migration and invasion. ADCs Toxin[1]. |
| Name | 17-AEP-GA |
|---|
| Description | 17-AEP-GA, an HSP90 antagonist, is a potent inhibitor of glioblastoma cell proliferation, survival, migration and invasion. ADCs Toxin[1]. |
|---|---|
| Related Catalog | |
| Target |
HSP90 Traditional Cytotoxic Agents |
| References |
| Molecular Formula | C34H50N4O8 |
|---|---|
| Molecular Weight | 642.78 |
| InChIKey | MNMYYWFEPBLDKF-JEVRCCDFSA-N |
| SMILES | COC1C=CC=C(C)C(=O)NC2=CC(=O)C(NCCN3CCCC3)=C(CC(C)CC(OC)C(O)C(C)C=C(C)C1OC(N)=O)C2=O |