17-GMB-APA-GA structure
|
Common Name | 17-GMB-APA-GA | ||
|---|---|---|---|---|
| CAS Number | 256337-10-7 | Molecular Weight | 767.87 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H53N5O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 17-GMB-APA-GA17-GMB-APA-GA is an ADC Cytotoxin. 17-GMB-APA-GA is a potent HSP90 inhibitor and used for latent T. gondii infection research[1]. |
| Name | 17-GMB-APA-GA |
|---|
| Description | 17-GMB-APA-GA is an ADC Cytotoxin. 17-GMB-APA-GA is a potent HSP90 inhibitor and used for latent T. gondii infection research[1]. |
|---|---|
| Related Catalog | |
| Target |
HSP90 Traditional Cytotoxic Agents |
| References |
| Molecular Formula | C39H53N5O11 |
|---|---|
| Molecular Weight | 767.87 |
| InChIKey | OPWAYYOLUIAKCJ-WOTUWNQMSA-N |
| SMILES | COC1C=CC=C(C)C(=O)NC2=CC(=O)C(NCCCNC(=O)CCCN3C(=O)C=CC3=O)=C(CC(C)CC(OC)C(O)C(C)C=C(C)C1OC(N)=O)C2=O |