(2-CHLORO-1,3-THIAZOL-5-YL)METHYLACETATE structure
|
Common Name | (2-CHLORO-1,3-THIAZOL-5-YL)METHYLACETATE | ||
|---|---|---|---|---|
| CAS Number | 75823-64-2 | Molecular Weight | 250.11700 | |
| Density | 1.965g/cm3 | Boiling Point | 128ºC | |
| Molecular Formula | C7H5F7N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methyl-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.965g/cm3 |
|---|---|
| Boiling Point | 128ºC |
| Molecular Formula | C7H5F7N2 |
| Molecular Weight | 250.11700 |
| Exact Mass | 250.03400 |
| PSA | 28.68000 |
| LogP | 3.00750 |
| Index of Refraction | 1.443 |
| InChIKey | HGKNTSQKMGECCF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(F)(F)C(F)(F)C(F)(F)F)n[nH]1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933199090 |
|
~78%
(2-CHLORO-1,3-T... CAS#:75823-64-2 |
| Literature: Peglion, Jean-Louis; Pastor, Raphael-Emile; Cambon, Aime-Roger Bulletin de la Societe Chimique de France, 1980 , vol. 2, # 5-6 p. 309 - 315 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(Heptafluoropropyl)-5-methypyrazole |
| 3-(heptafluoropropyl)-5-methyl-1H-pyrazole |
| PC8167 |