d-3-bromocamphor structure
|
Common Name | d-3-bromocamphor | ||
|---|---|---|---|---|
| CAS Number | 76-29-9 | Molecular Weight | 231.12900 | |
| Density | 1.449 g/cm3 | Boiling Point | 245.6ºC at 760 mmHg | |
| Molecular Formula | C10H15BrO | Melting Point | 75-77ºC | |
| MSDS | N/A | Flash Point | 35.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.449 g/cm3 |
|---|---|
| Boiling Point | 245.6ºC at 760 mmHg |
| Melting Point | 75-77ºC |
| Molecular Formula | C10H15BrO |
| Molecular Weight | 231.12900 |
| Flash Point | 35.8ºC |
| Exact Mass | 230.03100 |
| PSA | 17.07000 |
| LogP | 2.77510 |
| Index of Refraction | 1.528 |
| InChIKey | NJQADTYRAYFBJN-UHFFFAOYSA-N |
| SMILES | CC12CCC(C(Br)C1=O)C2(C)C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36-S37-S39 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 8 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Bromobornan-2-one |
| 3-bromo-2-bornanon |
| D-3-BROMOCAMPHOR |
| 3-bromo-campho |
| 3-Bromo-2-bornanone |
| camphor,3-bromo |
| EINECS 200-950-8 |
| MFCD00065907 |
| bromo-3 camphre |
| 3-BROMOCAMPHOR |
| bromocamphor |
| D-MONOBROMOCAMPHOR |
| D-bromocamphor |
| D-A-BROMOCAMPHOR |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one? |
| A: Molecular formula of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is C10H15BrO. |
| Q: What is the InChIKey of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one? |
| A: InChIKey of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is NJQADTYRAYFBJN-UHFFFAOYSA-N. |
| Q: What English synonyms does 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one have? |
| A: English synonyms of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one: 3-Bromobornan-2-one, 3-bromo-2-bornanon, D-3-BROMOCAMPHOR, 3-bromo-campho, 3-Bromo-2-bornanone, camphor,3-bromo, EINECS 200-950-8, MFCD00065907, bromo-3 camphre, 3-BROMOCAMPHOR, bromocamphor, D-MONOBROMOCAMPHOR, D-bromocamphor, D-A-BROMOCAMPHOR. |
| Q: What is the CAS number of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one? |
| A: CAS number of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is 76-29-9. |
| Q: What is the molecular weight of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one? |
| A: Molecular weight of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is 231.12900. |
| Q: What is the LogP of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one? |
| A: LogP of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is 2.77510. |
| Q: What is the melting point of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one? |
| A: Melting point of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is 75-77ºC. |
| Q: What is the SMILES notation of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one? |
| A: SMILES notation of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is CC12CCC(C(Br)C1=O)C2(C)C. |
| Q: What is the polar surface area (PSA) of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one? |
| A: Polar surface area (PSA) of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is 17.07000. |
| Q: What is the English name of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one? |
| A: The English name of 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is 3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |