ethyl 4-hydroxy-2-methyl-6-oxo-5-phenyl-1H-pyridine-3-carboxylate structure
|
Common Name | ethyl 4-hydroxy-2-methyl-6-oxo-5-phenyl-1H-pyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 76066-86-9 | Molecular Weight | 273.28400 | |
| Density | 1.284g/cm3 | Boiling Point | 448.9ºC at 760 mmHg | |
| Molecular Formula | C15H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.3ºC | |
| Name | ethyl 4-hydroxy-2-methyl-6-oxo-5-phenyl-1H-pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 448.9ºC at 760 mmHg |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.28400 |
| Flash Point | 225.3ºC |
| Exact Mass | 273.10000 |
| PSA | 79.65000 |
| LogP | 2.64490 |
| Index of Refraction | 1.592 |
| InChIKey | WCTVEONIUSTFIF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)[nH]c(=O)c(-c2ccccc2)c1O |
|
~57%
ethyl 4-hydroxy... CAS#:76066-86-9 |
| Literature: Ukrainets; Sidorenko; Gorokhova; Shishkin Chemistry of Heterocyclic Compounds, 2006 , vol. 42, # 2 p. 191 - 196 |
|
~59%
ethyl 4-hydroxy... CAS#:76066-86-9 |
| Literature: Dannhardt, G; Meindl, W; Schober, B D; Kappe, T European Journal of Medicinal Chemistry, 1991 , vol. 26, # 6 p. 599 - 604 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| ethyl 4-hydroxy-6-methyl-2-oxo-3-phenyl-1,2-dihydropyridine-5-carboxylate |
| 4-hydroxy-2-methyl-6-oxo-5-phenyl-1,6-dihydro-pyridine-3-carboxylic acid ethyl ester |
| 5-Ethoxycarbonyl-4-hydroxy-6-methyl-3-phenyl-2-pyridon |
| ethyl 4-hydroxy-6-methyl-3-phenyl-2-oxo-1,2-dihydropyridine-5-carboxylate |
| ethyl 6-hydroxy-2-methyl-4-oxo-5-phenyl-1H-pyridine-3-carboxylate |