5-Fluoro-2-nitroanisole structure
|
Common Name | 5-Fluoro-2-nitroanisole | ||
|---|---|---|---|---|
| CAS Number | 448-19-1 | Molecular Weight | 171.126 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 245.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H6FNO3 | Melting Point | 49-51ºC | |
| MSDS | Chinese USA | Flash Point | 102.5±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Fluoro-2-nitroanisole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 245.8±20.0 °C at 760 mmHg |
| Melting Point | 49-51ºC |
| Molecular Formula | C7H6FNO3 |
| Molecular Weight | 171.126 |
| Flash Point | 102.5±21.8 °C |
| Exact Mass | 171.033173 |
| PSA | 55.05000 |
| LogP | 1.63 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | WLKUSVNHZXUEFO-UHFFFAOYSA-N |
| SMILES | COc1cc(F)ccc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 22-52 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2909309090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| WNR DF BO1 |
| MFCD00077541 |
| 4-Fluoro-2-methoxy-1-nitrobenzene |
| Benzene, 4-fluoro-2-methoxy-1-nitro- |
| 5-Fluoro-2-nitrophenyl methyl ether |
| 5-Fluoro-2-nitroanisole |