1-(Bromomethyl)-4-fluoro-2-nitrobenzene structure
|
Common Name | 1-(Bromomethyl)-4-fluoro-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 76437-44-0 | Molecular Weight | 234.023 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 280.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H5BrFNO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 123.6±23.2 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 4-Fluoro-2-Nitrobenzyl Bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 280.8±25.0 °C at 760 mmHg |
| Molecular Formula | C7H5BrFNO2 |
| Molecular Weight | 234.023 |
| Flash Point | 123.6±23.2 °C |
| Exact Mass | 232.948761 |
| PSA | 45.82000 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | NBRNHHKYVFAXCZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(F)ccc1CBr |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| RIDADR | UN 3265 8 / PGII |
| HS Code | 2904909090 |
|
~43%
1-(Bromomethyl)... CAS#:76437-44-0 |
| Literature: McCord, Tommy J.; Crawford, Charles P.; Rabon, James A.; Gage Larry D.; Winter, J. Mark; Davis, Alvie L. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 401 - 406 |
|
~%
1-(Bromomethyl)... CAS#:76437-44-0 |
| Literature: US2011/53947 A1, ; Page/Page column 61 ; |
|
~%
1-(Bromomethyl)... CAS#:76437-44-0 |
| Literature: US5504095 A1, ; |
|
~%
1-(Bromomethyl)... CAS#:76437-44-0 |
| Literature: US4385070 A1, ; |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1-(bromomethyl)-4-fluoro-2-nitro- |
| 1-(Bromomethyl)-4-fluoro-2-nitrobenzene |
| 4-FLUORO-2-NITROBENZYLBROMIDE |