4-[4-[(4-chlorophenyl)methylidene]-2,3-dioxo-pyrrolidin-1-yl]butanoic acid structure
|
Common Name | 4-[4-[(4-chlorophenyl)methylidene]-2,3-dioxo-pyrrolidin-1-yl]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 76628-88-1 | Molecular Weight | 307.72900 | |
| Density | 1.413g/cm3 | Boiling Point | 528.6ºC at 760 mmHg | |
| Molecular Formula | C15H14ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.5ºC | |
| Name | 4-[4-[(4-chlorophenyl)methylidene]-2,3-dioxopyrrolidin-1-yl]butanoic acid |
|---|
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 528.6ºC at 760 mmHg |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.72900 |
| Flash Point | 273.5ºC |
| Exact Mass | 307.06100 |
| PSA | 74.68000 |
| LogP | 1.93740 |
| Index of Refraction | 1.635 |
| InChIKey | IHMJGJHSVALKTR-DHZHZOJOSA-N |
| SMILES | O=C(O)CCCN1CC(=Cc2ccc(Cl)cc2)C(=O)C1=O |
|
~42%
4-[4-[(4-chloro... CAS#:76628-88-1 |
| Literature: Madhav; Snyder; Southwick Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 6 p. 1231 - 1235 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |