Boc-O-ethyl-D-tyrosine structure
|
Common Name | Boc-O-ethyl-D-tyrosine | ||
|---|---|---|---|---|
| CAS Number | 76757-92-1 | Molecular Weight | 309.35800 | |
| Density | N/A | Boiling Point | 472.7±40.0°C | |
| Molecular Formula | C16H23NO5 | Melting Point | 80-81°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R)-3-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 472.7±40.0°C |
|---|---|
| Melting Point | 80-81°C |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.35800 |
| Exact Mass | 309.15800 |
| PSA | 84.86000 |
| LogP | 2.99660 |
| InChIKey | NCLAAKQIHUIOIV-CYBMUJFWSA-N |
| SMILES | CCOc1ccc(CC(NC(=O)OC(C)(C)C)C(=O)O)cc1 |
| Storage condition | Store at RT. |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
|
~64%
Boc-O-ethyl-D-t... CAS#:76757-92-1 |
| Literature: Manning; Olma; Klis; Kolodziejczyk; Seto; Sawyer Journal of Medicinal Chemistry, 1982 , vol. 25, # 1 p. 45 - 50 |
|
~%
Boc-O-ethyl-D-t... CAS#:76757-92-1 |
| Literature: Journal of Organic Chemistry, , vol. 46, # 9 p. 1944 - 1946 |
|
~%
Boc-O-ethyl-D-t... CAS#:76757-92-1 |
| Literature: Journal of Organic Chemistry, , vol. 46, # 9 p. 1944 - 1946 |
|
~%
Boc-O-ethyl-D-t... CAS#:76757-92-1 |
| Literature: Journal of Organic Chemistry, , vol. 46, # 9 p. 1944 - 1946 |
|
~%
Boc-O-ethyl-D-t... CAS#:76757-92-1 |
| Literature: Journal of Organic Chemistry, , vol. 48, # 22 p. 4127 - 4129 |
|
~%
Boc-O-ethyl-D-t... CAS#:76757-92-1 |
| Literature: Journal of Organic Chemistry, , vol. 46, # 9 p. 1944 - 1946 |
|
~%
Boc-O-ethyl-D-t... CAS#:76757-92-1 |
| Literature: Journal of Organic Chemistry, , vol. 46, # 9 p. 1944 - 1946 |
| (R)-2-tert-butoxycarbonylamino-3-(4-ethoxy-phenyl)-propionic acid |
| (2R)-2-[(tert-butoxycarbonyl)amino]-3-(4-ethoxyphenyl)propanoic acid |
| Boc-D-Tyr(Et)-OH |
| Boc-O-ethyl-D-tyrosine |
| Boc-D-Tyr(OEt) |
| N-(tert-butoxycarbonyl)-O-ethyl-D-tyrosine |
| t-Boc-D-tyrosine ethyl ether |
| AmbotzBAA1456 |
| MFCD00065602 |
| Boc-D-(O-Et)TyrOH |