Garcinone C structure
|
Common Name | Garcinone C | ||
|---|---|---|---|---|
| CAS Number | 76996-27-5 | Molecular Weight | 414.448 | |
| Density | 1.367 | Boiling Point | 689.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H26O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.7±25.0 °C | |
Use of Garcinone CGarcinone C, a xanthone derivative, is a natural compound extracted from Garcinia oblongifolia Champ that is used as an anti-inflammatory, analgesia, astringency and granulation-promoting medicine, and has potential cytotoxic effects on certain cancers. Garcinone C stimulates the expression levels of ATR and 4E-BP1, while efficiently inhibiting the expression levels of cyclin B1, cyclin D1, cyclin E2, cdc2, Stat3 and CDK7. Garcinone C significantly inhibits cell viability of the human Nasopharyngeal carcinoma (NPC) cell lines CNE1, CNE2, HK1 and HONE1 in a time‑ and dose‑dependent manner[1]. |
| Name | 1,3,6,7-tetrahydroxy-8-(3-hydroxy-3-methylbutyl)-2-(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Description | Garcinone C, a xanthone derivative, is a natural compound extracted from Garcinia oblongifolia Champ that is used as an anti-inflammatory, analgesia, astringency and granulation-promoting medicine, and has potential cytotoxic effects on certain cancers. Garcinone C stimulates the expression levels of ATR and 4E-BP1, while efficiently inhibiting the expression levels of cyclin B1, cyclin D1, cyclin E2, cdc2, Stat3 and CDK7. Garcinone C significantly inhibits cell viability of the human Nasopharyngeal carcinoma (NPC) cell lines CNE1, CNE2, HK1 and HONE1 in a time‑ and dose‑dependent manner[1]. |
|---|---|
| Related Catalog | |
| Target |
ATR Stat-3 CDK7 |
| References |
| Density | 1.367 |
|---|---|
| Boiling Point | 689.0±55.0 °C at 760 mmHg |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.448 |
| Flash Point | 239.7±25.0 °C |
| Exact Mass | 414.167847 |
| PSA | 131.36000 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | HLOCLVMUASBDDP-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(O)cc2oc3cc(O)c(O)c(CCC(C)(C)O)c3c(=O)c2c1O |
| Hazard Codes | Xi |
|---|
| 1,3,6,7-Tetrahydroxy-8-(3-hydroxy-3-methylbutyl)-2-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one |
| Garcinone C |
| 9H-Xanthen-9-one, 1,3,6,7-tetrahydroxy-8-(3-hydroxy-3-methylbutyl)-2-(3-methyl-2-buten-1-yl)- |