acetyl triethyl citrate structure
|
Common Name | acetyl triethyl citrate | ||
|---|---|---|---|---|
| CAS Number | 77-89-4 | Molecular Weight | 318.320 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 327.2±37.0 °C at 760 mmHg | |
| Molecular Formula | C14H22O8 | Melting Point | -42°C | |
| MSDS | Chinese USA | Flash Point | 136.9±26.5 °C | |
| Name | Triethyl O-Acetylcitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 327.2±37.0 °C at 760 mmHg |
| Melting Point | -42°C |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.320 |
| Flash Point | 136.9±26.5 °C |
| Exact Mass | 318.131470 |
| PSA | 105.20000 |
| LogP | 3.73 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | WEAPVABOECTMGR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(OC(C)=O)C(=O)OCC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S23-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| RTECS | GE8225000 |
| HS Code | 2918990090 |
|
~92%
acetyl triethyl... CAS#:77-89-4 |
| Literature: Liu, Zhihui; Ma, Qiaoqiao; Liu, Yuxiu; Wang, Qingmin Organic Letters, 2014 , vol. 16, # 1 p. 236 - 239 |
|
~%
acetyl triethyl... CAS#:77-89-4 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 129, p. 187 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Physiological relevant in vitro evaluation of polymer coats for gastroretentive floating tablets.
Eur. J. Pharm. Biopharm. 88(3) , 778-86, (2014) Gastroretentive drug delivery systems are retained in the stomach for a sufficient time interval, releasing the drug in a controlled manner. According to literature, the floating principle is the most... |
| 2-(Acetyloxy)-1,2,3-propanetricarboxylic Acid Triethyl Ester |
| Citric Acid Acetyl Triethyl Ester |
| acetyl triethyl citrate |
| EINECS 201-066-5 |
| 1,2,3-Propanetricarboxylic acid, 2-(acetyloxy)-, triethyl ester |
| Triethyl 2-acetoxypropane-1,2,3-tricarboxylate |
| Citroflex A2 |
| Tricarballylic Acid b-Acetoxytributyl Ester |
| triethyl 2-(acetyloxy)propane-1,2,3-tricarboxylate |
| Triethyl 2-acetoxy-1,2,3-propanetricarboxylate |
| MFCD00049378 |
| O-Acetylcitric Acid Triethyl Ester |
| triethyl 2-acetyloxypropane-1,2,3-tricarboxylate |