mesitylene-2-sulfonyl chloride structure
|
Common Name | mesitylene-2-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 773-64-8 | Molecular Weight | 218.700 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 303.1±41.0 °C at 760 mmHg | |
| Molecular Formula | C9H11ClO2S | Melting Point | 55-57 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 137.1±27.6 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2-Mesitylenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 303.1±41.0 °C at 760 mmHg |
| Melting Point | 55-57 °C(lit.) |
| Molecular Formula | C9H11ClO2S |
| Molecular Weight | 218.700 |
| Flash Point | 137.1±27.6 °C |
| Exact Mass | 218.016830 |
| PSA | 42.52000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | PVJZBZSCGJAWNG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1 |
| Storage condition | Store at RT. |
| Water Solubility | insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R29;R34 |
| Safety Phrases | S22-S26-S27-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DB8930000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29309070 |
|
~80%
mesitylene-2-su... CAS#:773-64-8 |
| Literature: Faber, Wijnand S.; Kok, Johan; De Lange, Ben; Feringa, Ben L. Tetrahedron, 1994 , vol. 50, # 16 p. 4775 - 4794 |
|
~93%
mesitylene-2-su... CAS#:773-64-8 |
| Literature: Blotny, Grzegorz Tetrahedron Letters, 2003 , vol. 44, # 7 p. 1499 - 1501 |
|
~62%
mesitylene-2-su... CAS#:773-64-8 |
| Literature: Blotny, Grzegorz Tetrahedron Letters, 2003 , vol. 44, # 7 p. 1499 - 1501 |
|
~%
mesitylene-2-su... CAS#:773-64-8 |
| Literature: Monatshefte fuer Chemie, , vol. 34, p. 576 |
|
~%
mesitylene-2-su... CAS#:773-64-8 |
| Literature: Chemische Berichte, , vol. 26, p. 2942 |
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Tetrahedron 48 , 1729, (1992)
|
| Benzenesulfonyl chloride, 2,4,6-trimethyl- |
| MFCD00007434 |
| mesitylene-2-sulfonyl chloride |
| EINECS 212-257-8 |
| 2,4,6-Trimethylbenzenesulfonyl chloride |
| 2-Mesitylenesulfonyl chloride (8CI) |