Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate structure
|
Common Name | Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate | ||
|---|---|---|---|---|
| CAS Number | 38202-27-6 | Molecular Weight | 285.359 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 381.7±52.0 °C at 760 mmHg | |
| Molecular Formula | C13H19NO4S | Melting Point | 54-56 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 184.7±30.7 °C | |
| Name | Ethyl O-mesitylsulfonylacetohydroxamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 381.7±52.0 °C at 760 mmHg |
| Melting Point | 54-56 °C(lit.) |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.359 |
| Flash Point | 184.7±30.7 °C |
| Exact Mass | 285.103485 |
| PSA | 73.34000 |
| LogP | 4.00 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | KQCBSWBQAXTILK-WYMLVPIESA-N |
| SMILES | CCOC(C)=NOS(=O)(=O)c1c(C)cc(C)cc1C |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925290090 |
|
~89%
Ethyl N-[(mesit... CAS#:38202-27-6 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY; PRACITTO, Richard; KADOW, John, F.; BENDER, John, A.; BENO, Brett, R.; GRANT-YOUNG, Katharine; HAN, Ying; HEWAWASAM, Piyasena; NICKEL, Andrew; PARCELLA, Kyle, E.; YEUNG, Kap-Sun; CHUPAK, Louis, S. Patent: WO2011/112186 A1, 2011 ; Location in patent: Page/Page column 202 ; WO 2011/112186 A1 |
|
~94%
Ethyl N-[(mesit... CAS#:38202-27-6 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY; PRACITTO, Richard; KADOW, John F.; BENDER, John A.; BENO, Brett R.; GRANT-YOUNG, Katharine A.; HAN, Ying; HEWAWASAM, Piyasena; NICKEL, Andrew; PARCELLA, Kyle E.; YEUNG, Kap-Sun; CHUPAK, Louis S. Patent: WO2010/30538 A2, 2010 ; Location in patent: Page/Page column 203 ; |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Y. Taura, J. Minamikawa
Synthesis , 1, (1977)
|
| Ethyl O-mesitylsulfo |
| O-Mesitylsulfonylacetohydroxamic Acid Ethyl Ester |
| O-(Mesitylsulfonyl)acetohydroxamsaeure-ethylester |
| Ethanimidic acid, N-[[(2,4,6-trimethylphenyl)sulfonyl]oxy]-, ethyl ester |
| Ehylo-(2-mesitylenesulfonyl)acet-hydroxamate |
| Ethyl O-MesitylsulfonylacetohydroxaMate |
| ethyl O-(2-mesitylsulfonyl)acethydroxamate |
| Ethyl o-(mesitylsulfonyl)acetohydroximate |
| ethyl O-methylsulphonylacetohydroxamate |
| Ethyl N-(mesitylsulfonyl)oxyacetimidate |
| ethyl O-(mesitylsulfonyl)acetohydroxamate |
| ethyl O-(2-mesitylenesulfonyl)acethydroxamate |
| Ethyl O-methylsulfonylacetohydroxamate. |
| EINECS 253-825-5 |
| Ethyl N-[(mesitylsulfonyl)oxy]ethanimidate |
| ethyl O-mesitylenesulfonylacetohydroxamate |
| MFCD00009244 |
| ethyl O-(mesitylenesulfonyl)acetohydroximate |
| O-Mesityl sulfonyl acetohydroxamic acid ethylester;98%, |