Mononmethyl succinate structure
|
Common Name | Mononmethyl succinate | ||
|---|---|---|---|---|
| CAS Number | 77341-67-4 | Molecular Weight | 256.338 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 374.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.3±16.7 °C | |
| Name | 4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.3±25.0 °C at 760 mmHg |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.338 |
| Flash Point | 132.3±16.7 °C |
| Exact Mass | 256.167450 |
| PSA | 63.60000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | BLILOGGUTRWFNI-GRYCIOLGSA-N |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CCC(=O)O)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Mononmethyl succinate |
| UNII-85MHF9Y3DI |
| Butanedioic acid, mono[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester |
| Monomenthyl succinate |
| L-monomenthyl succinate |
| 4-{[(1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl]oxy}-4-oxobutanoic acid |
| L6TJ AY1&1 BOV2VQ D1 &&(1R,2S,5R)- Form |
| L-menthylsuccinic acid |
| Mono[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl]butanoate |