2,5-Pyrazinedipropanoic acid structure
|
Common Name | 2,5-Pyrazinedipropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 77479-02-8 | Molecular Weight | 224.21300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[5-(2-carboxyethyl)pyrazin-2-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12N2O4 |
|---|---|
| Molecular Weight | 224.21300 |
| Exact Mass | 224.08000 |
| PSA | 100.38000 |
| LogP | 0.51100 |
| InChIKey | LPCBENZWRKDJSS-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1cnc(CCC(=O)O)cn1 |
| RIDADR | NONH for all modes of transport |
|---|
|
~%
2,5-Pyrazinedip... CAS#:77479-02-8 |
| Literature: Bunke; Zerbe; Schmid; Burmeister; Merkle; Gander Journal of Pharmaceutical Sciences, 2000 , vol. 89, # 10 p. 1335 - 1341 |
|
~26%
2,5-Pyrazinedip... CAS#:77479-02-8 |
| Literature: Franck, Burchard; Stratmann, Helmut Heterocycles, 1981 , vol. 15, # 2 p. 919 - 923 |
|
~%
2,5-Pyrazinedip... CAS#:77479-02-8 |
| Literature: Butler; George Tetrahedron, 1992 , vol. 48, # 37 p. 7879 - 7886 |
|
~%
2,5-Pyrazinedip... CAS#:77479-02-8 |
| Literature: Bunke; Zerbe; Schmid; Burmeister; Merkle; Gander Journal of Pharmaceutical Sciences, 2000 , vol. 89, # 10 p. 1335 - 1341 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,5-dicarboxyethylpyrazine |
| pyrazine 2,5-dipropionic acid |
| 2,5-Pyrazinedipropanoic acid |
| 2,5-pyrazinedipropionic acid |