1H-Benz[f]indazole-3-carboxylic acid, 4,9-dihydro-4,9-dioxo-, ethyl ester structure
|
Common Name | 1H-Benz[f]indazole-3-carboxylic acid, 4,9-dihydro-4,9-dioxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7770-21-0 | Molecular Weight | 270.24000 | |
| Density | 1.46g/cm3 | Boiling Point | 544.3ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283ºC | |
| Name | ethyl 4,9-dioxo-2H-benzo[f]indazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 544.3ºC at 760 mmHg |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24000 |
| Flash Point | 283ºC |
| Exact Mass | 270.06400 |
| PSA | 89.12000 |
| LogP | 1.36180 |
| Index of Refraction | 1.651 |
| InChIKey | JHYNFTZWBJKHSN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]nc2c1C(=O)c1ccccc1C2=O |
|
~%
1H-Benz[f]indaz... CAS#:7770-21-0 |
| Literature: Fieser; Peters Journal of the American Chemical Society, 1931 , vol. 53, p. 4080,4092 |
|
~48%
1H-Benz[f]indaz... CAS#:7770-21-0 |
| Literature: Tandon, Vishnu K.; Yadav, Dharmendra B.; Chaturvedi, Ashok K.; Shukla, Praveen K. Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 13 p. 3288 - 3291 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,9-dioxo-4,9-dihydro-1(2)H-benz[f]indazole-3-carboxylic acid ethyl ester |
| 4,9-Dioxo-4,9-dihydro-1(2)H-benz[f]indazol-3-carbonsaeure-aethylester |
| 1H-benz[f]indazole-3-carboxylic acid,4,9-dihydro-4,9-dioxo-,ethyl ester |