L-Threonic acid magnesium salt structure
|
Common Name | L-Threonic acid magnesium salt | ||
|---|---|---|---|---|
| CAS Number | 778571-57-6 | Molecular Weight | 294.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14MgO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-Threonic acid magnesium saltL-Threonic acid magnesium salt is the enantiomer of Threonic acid and a metabolite of vitamin C. L-Ascorbic acid (L-Ascorbate), an electron donor, is an endogenous antioxidant agent[1]. |
| Name | Magnesium (2R,3S)-2,3,4-trihydroxybutanoate |
|---|---|
| Synonym | More Synonyms |
| Description | L-Threonic acid magnesium salt is the enantiomer of Threonic acid and a metabolite of vitamin C. L-Ascorbic acid (L-Ascorbate), an electron donor, is an endogenous antioxidant agent[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C8H14MgO10 |
|---|---|
| Molecular Weight | 294.50 |
| Exact Mass | 294.043732 |
| PSA | 201.64000 |
| InChIKey | YVJOHOWNFPQSPP-BALCVSAKSA-L |
| SMILES | O=C([O-])C(O)C(O)CO.O=C([O-])C(O)C(O)CO.[Mg+2] |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918199090 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Magnesium L-Threonate |
| magnesium,(2R,3S)-2,3,4-trihydroxybutanoate |
| L-Threonic acid magnesium salt |
| Magnesium bis[(2R,3S)-2,3,4-trihydroxybutanoate] |
| Butanoic acid, 2,3,4-trihydroxy-, magnesium salt, (2R,3S)- (2:1) |