N1,N12-Diacetylspermine dihydrochloride structure
|
Common Name | N1,N12-Diacetylspermine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 77928-71-3 | Molecular Weight | 359.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H32Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N1,N12-Diacetylspermine dihydrochlorideN1,N12-Diacetylspermine dihydrochloride is a diacetylated derivative of spermine. Upregulation of N1,N12-Diacetylspermine dihydrochloride has been linked to the incidence of cancer, making it to be a potential biomarker for cancer detection. |
| Name | N1,N12-Diacetylspermine dihydrochloride |
|---|
| Description | N1,N12-Diacetylspermine dihydrochloride is a diacetylated derivative of spermine. Upregulation of N1,N12-Diacetylspermine dihydrochloride has been linked to the incidence of cancer, making it to be a potential biomarker for cancer detection. |
|---|
| Molecular Formula | C14H32Cl2N4O2 |
|---|---|
| Molecular Weight | 359.34 |
| InChIKey | NQNXERHVLXYXRO-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCCNCCCCNCCCNC(C)=O.Cl.Cl |
| Storage condition | -20°C |