2-Butenoic acid,4-[(4-fluorophenyl)amino]-4-oxo-, (2Z)- structure
|
Common Name | 2-Butenoic acid,4-[(4-fluorophenyl)amino]-4-oxo-, (2Z)- | ||
|---|---|---|---|---|
| CAS Number | 780-05-2 | Molecular Weight | 209.17400 | |
| Density | 1.413g/cm3 | Boiling Point | 437.3ºC at 760 mmHg | |
| Molecular Formula | C10H8FNO3 | Melting Point | 207-209ºC | |
| MSDS | N/A | Flash Point | 218.2ºC | |
| Name | (Z)-4-(4-fluoroanilino)-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 437.3ºC at 760 mmHg |
| Melting Point | 207-209ºC |
| Molecular Formula | C10H8FNO3 |
| Molecular Weight | 209.17400 |
| Flash Point | 218.2ºC |
| Exact Mass | 209.04900 |
| PSA | 66.40000 |
| LogP | 1.47800 |
| Index of Refraction | 1.611 |
| InChIKey | NRDZVHHPNZDWRA-WAYWQWQTSA-N |
| SMILES | O=C(O)C=CC(=O)Nc1ccc(F)cc1 |
|
~90%
2-Butenoic acid... CAS#:780-05-2 |
| Literature: Majce, Vita; Kocevar, Marijan; Polanc, Slovenko Tetrahedron Letters, 2011 , vol. 52, # 26 p. 3287 - 3290 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00082643 |
| i04-5359 |