1-methyl-4-(4-nitrophenoxy)-4-phenylpiperidine structure
|
Common Name | 1-methyl-4-(4-nitrophenoxy)-4-phenylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 78104-06-0 | Molecular Weight | 312.36300 | |
| Density | 1.194g/cm3 | Boiling Point | 460.3ºC at 760 mmHg | |
| Molecular Formula | C18H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.2ºC | |
| Name | 1-methyl-4-(4-nitrophenoxy)-4-phenylpiperidine |
|---|
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 460.3ºC at 760 mmHg |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.36300 |
| Flash Point | 232.2ºC |
| Exact Mass | 312.14700 |
| PSA | 58.29000 |
| LogP | 4.05580 |
| Index of Refraction | 1.592 |
| InChIKey | FPKCHECNDCATAH-UHFFFAOYSA-N |
| SMILES | CN1CCC(Oc2ccc([N+](=O)[O-])cc2)(c2ccccc2)CC1 |
|
~%
1-methyl-4-(4-n... CAS#:78104-06-0 |
| Literature: John Wyeth and Brother Limited Patent: US4325953 A1, 1982 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |