4-(1-methyl-4-phenylpiperidin-4-yl)oxyaniline structure
|
Common Name | 4-(1-methyl-4-phenylpiperidin-4-yl)oxyaniline | ||
|---|---|---|---|---|
| CAS Number | 78104-11-7 | Molecular Weight | 282.38000 | |
| Density | 1.121g/cm3 | Boiling Point | 436.7ºC at 760 mmHg | |
| Molecular Formula | C18H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.9ºC | |
| Name | 4-(1-methyl-4-phenylpiperidin-4-yl)oxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.121g/cm3 |
|---|---|
| Boiling Point | 436.7ºC at 760 mmHg |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.38000 |
| Flash Point | 217.9ºC |
| Exact Mass | 282.17300 |
| PSA | 38.49000 |
| LogP | 3.78780 |
| Index of Refraction | 1.6 |
| InChIKey | GNVZOTBLCYEIRW-UHFFFAOYSA-N |
| SMILES | CN1CCC(Oc2ccc(N)cc2)(c2ccccc2)CC1 |
|
~%
4-(1-methyl-4-p... CAS#:78104-11-7 |
| Literature: John Wyeth and Brother Limited Patent: US4325953 A1, 1982 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| b 777-81 |