N-Boc-2-indolyldimethylsilanol
Modify Date: 2025-08-27 16:22:08
N-Boc-2-indolyldimethylsilanol structure
|
Common Name | N-Boc-2-indolyldimethylsilanol | ||
|---|---|---|---|---|
| CAS Number | 784161-48-4 | Molecular Weight | 291.41800 | |
| Density | 1.08g/cm3 | Boiling Point | 397.5ºC at 760 mmHg | |
| Molecular Formula | C15H21NO3Si | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 194.2ºC | |
| Name | tert-butyl 2-[hydroxy(dimethyl)silyl]indole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 397.5ºC at 760 mmHg |
| Molecular Formula | C15H21NO3Si |
| Molecular Weight | 291.41800 |
| Flash Point | 194.2ºC |
| Exact Mass | 291.12900 |
| PSA | 51.46000 |
| LogP | 2.82890 |
| Index of Refraction | 1.524 |
| InChIKey | ARJIKJGACIMUOM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1c([Si](C)(C)O)cc2ccccc21 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933990090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:1528-74-1
CAS#:193810-88-7| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Denmark, S. E.; Ober, M. H.
Aldrichimica Acta 36 , 75, (2003)
|
| N-Boc-dimethyl(2-indolyl)silanol |
| MFCD08457643 |
| N-Boc-indol-2-yldimethylsilanol |
| 1-Boc-2-indolyldimethylsilanol |
| 2-(hydroxydimethylsilyl)-1H-indole-1-carboxylic acid 1,1-dimethylethyl ester |
| 2-(hydroxydimethylsilyl)-1,1-dimethylethylindole-1-carboxylic acid ester |
| N-(BOC)-2-INDOLYLDIMETHYLSILANOL |
| AMTSi008 |