4-Cbz-piperazinone structure
|
Common Name | 4-Cbz-piperazinone | ||
|---|---|---|---|---|
| CAS Number | 78818-15-2 | Molecular Weight | 234.251 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 459.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H14N2O3 | Melting Point | 118-120°C | |
| MSDS | Chinese USA | Flash Point | 231.9±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Benzyl 3-Oxopiperazine-1-Carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 459.8±45.0 °C at 760 mmHg |
| Melting Point | 118-120°C |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.251 |
| Flash Point | 231.9±28.7 °C |
| Exact Mass | 234.100449 |
| PSA | 58.64000 |
| LogP | -0.45 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | BAHFPJFBMJTOPU-UHFFFAOYSA-N |
| SMILES | O=C1CN(C(=O)OCc2ccccc2)CCN1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933599090 |
|
~10%
4-Cbz-piperazinone CAS#:78818-15-2 |
| Literature: Fryer, R. Ian; Kudzma, Linas V.; Gu, Zi-Qiang; Lin, Kuei-Ying Journal of Organic Chemistry, 1991 , vol. 56, # 11 p. 3715 - 3719 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00173924 |
| benzyl 3-oxopiperazine-1-carboxylate |
| 1-Piperazinecarboxylic acid, 3-oxo-, phenylmethyl ester |
| 4-Cbz-piperazinone |
| Benzyl 3-oxo-1-piperazinecarboxylate |