2-(4-methylsulfonylphenoxy)-5-nitrobenzonitrile structure
|
Common Name | 2-(4-methylsulfonylphenoxy)-5-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 78940-69-9 | Molecular Weight | 318.30500 | |
| Density | 1.49g/cm3 | Boiling Point | 498.9ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.6ºC | |
| Name | 2-(4-methylsulfonylphenoxy)-5-nitrobenzonitrile |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 498.9ºC at 760 mmHg |
| Molecular Formula | C14H10N2O5S |
| Molecular Weight | 318.30500 |
| Flash Point | 255.6ºC |
| Exact Mass | 318.03100 |
| PSA | 121.36000 |
| LogP | 4.26628 |
| Index of Refraction | 1.644 |
| InChIKey | QECMNWRMFRQXCB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc([N+](=O)[O-])cc2C#N)cc1 |
|
~%
2-(4-methylsulf... CAS#:78940-69-9 |
| Literature: The Dow Chemical Company Patent: US4332820 A1, 1982 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |