2-(4-methylphenoxy)-5-nitrobenzonitrile structure
|
Common Name | 2-(4-methylphenoxy)-5-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 99902-81-5 | Molecular Weight | 254.24100 | |
| Density | 1.31g/cm3 | Boiling Point | 369.4ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.2ºC | |
| Name | 2-(4-methylphenoxy)-5-nitrobenzonitrile |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 369.4ºC at 760 mmHg |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.24100 |
| Flash Point | 177.2ºC |
| Exact Mass | 254.06900 |
| PSA | 78.84000 |
| LogP | 4.09038 |
| Index of Refraction | 1.623 |
| InChIKey | FCKMQMJMGBFAIA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2ccc([N+](=O)[O-])cc2C#N)cc1 |
|
~%
2-(4-methylphen... CAS#:99902-81-5 |
| Literature: Markley; Tong; Dulworth; Steward; Goralski; Johnston; Wood; Vinogradoff; Bargar Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 427 - 433 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |