N-Boc-L-valinol structure
|
Common Name | N-Boc-L-valinol | ||
|---|---|---|---|---|
| CAS Number | 79069-14-0 | Molecular Weight | 203.279 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 303.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H21NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 137.1±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-BOC-L-Valinol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 303.1±25.0 °C at 760 mmHg |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.279 |
| Flash Point | 137.1±23.2 °C |
| Exact Mass | 203.152145 |
| PSA | 58.56000 |
| LogP | 1.71 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | OOQRRYDVICNJGC-MRVPVSSYSA-N |
| SMILES | CC(C)C(CO)NC(=O)OC(C)(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 2924199090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Caputo, R. et al.
Tetrahedron 51 , 12337, (1995)
|
|
|
R. Caputo et al.
Tetrahedron Lett. 36 , 167, (1995)
|
|
|
Tietze, L.F. Burkhardt, O.
Synthesis , 1331, (1994)
|
| tert-Butyl [(1S)-1-(hydroxymethyl)-2-methylpropyl]carbamate |
| Carbamic acid, N-[(1S)-1-(hydroxymethyl)-2-methylpropyl]-, 1,1-dimethylethyl ester |
| Carbamic acid, N-[(1R)-1-(hydroxymethyl)-2-methylpropyl]-, 1,1-dimethylethyl ester |
| N-t-BOC-D-Valinol |
| tert-butyl N-[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamate |
| tert-Butyl [(2S)-1-hydroxy-3-methylbutan-2-yl]carbamate |
| tert-Butyl [(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate |
| 2-Methyl-2-propanyl [(2R)-1-hydroxy-3-methyl-2-butanyl]carbamate |
| 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-methyl-2-butanyl]carbamate |
| MFCD00082635 |
| Boc-Val-ol |