boc-val-ome structure
|
Common Name | boc-val-ome | ||
|---|---|---|---|---|
| CAS Number | 58561-04-9 | Molecular Weight | 231.28900 | |
| Density | 1.02g/cm3 | Boiling Point | 306ºC at 760mmHg | |
| Molecular Formula | C11H21NO4 | Melting Point | 194℃ | |
| MSDS | USA | Flash Point | 138.9ºC | |
Use of boc-val-ome(S)-Methyl 2-((tert-butoxycarbonyl)amino)-3-methylbutanoate is a valine derivative[1]. |
| Name | methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-Methyl 2-((tert-butoxycarbonyl)amino)-3-methylbutanoate is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 306ºC at 760mmHg |
| Melting Point | 194℃ |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.28900 |
| Flash Point | 138.9ºC |
| Exact Mass | 231.14700 |
| PSA | 64.63000 |
| LogP | 2.09960 |
| Appearance of Characters | Liquid |
| Index of Refraction | n20/D 1.44(lit.) |
| InChIKey | XCJLIYKAMLUDGN-QMMMGPOBSA-N |
| SMILES | COC(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| BOC VALINE METHYLESTER |
| Boc-L-Val-OMe |
| N-Boc-L-valine methyl ester |
| MFCD00672510 |
| N-t-butoxycarbonyl-L-valine methyl ester |
| Boc-Val-OMe |
| N-Boc-L-Val-OMe |
| Boc-L-valine methyl ester |