3-(3,4-DICHLOROPHENOXY)BENZALDEHYDE structure
|
Common Name | 3-(3,4-DICHLOROPHENOXY)BENZALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 79124-76-8 | Molecular Weight | 267.10700 | |
| Density | 1.365g/cm3 | Boiling Point | 395.2ºC at 760mmHg | |
| Molecular Formula | C13H8Cl2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 166.4ºC | |
| Symbol |
GHS05, GHS07, GHS09 |
Signal Word | Danger | |
| Name | 3-(3,4-dichlorophenoxy)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 395.2ºC at 760mmHg |
| Molecular Formula | C13H8Cl2O2 |
| Molecular Weight | 267.10700 |
| Flash Point | 166.4ºC |
| Exact Mass | 265.99000 |
| PSA | 26.30000 |
| LogP | 4.59820 |
| Appearance of Characters | Liquid or Low Melting Solid,Colorless to yellow |
| Index of Refraction | n20/D 1.619(lit.) |
| InChIKey | ABQHJSHFFLAGHF-UHFFFAOYSA-N |
| SMILES | O=Cc1cccc(Oc2ccc(Cl)c(Cl)c2)c1 |
| Symbol |
GHS05, GHS07, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H317-H318-H410 |
| Precautionary Statements | P273-P280-P305 + P351 + P338-P501 |
| Personal Protective Equipment | Eyeshields;Gloves |
| Hazard Codes | C |
| Risk Phrases | 22-41-43-50/53 |
| Safety Phrases | 26-36/37/39-60-61 |
| RIDADR | UN 3082 9 / PGIII |
| HS Code | 2913000090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
Automated parallel synthesis of chalcone-based screening libraries. Powers DG, et al.
Tetrahedron 54(16) , 4085-96, (1998)
|
| einecs 279-069-6 |
| MFCD00003354 |