4-Pyridinecarboxylicacid, 2-[1-(4-methoxyphenyl)ethylidene]hydrazide structure
|
Common Name | 4-Pyridinecarboxylicacid, 2-[1-(4-methoxyphenyl)ethylidene]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 793-05-5 | Molecular Weight | 269.29900 | |
| Density | 1.15g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Pyridinecarboxylicacid, 2-[1-(4-methoxyphenyl)ethylidene]hydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.29900 |
| Exact Mass | 269.11600 |
| PSA | 63.58000 |
| LogP | 2.63510 |
| Index of Refraction | 1.579 |
| InChIKey | FUCZYYIIIVBUML-BOPFTXTBSA-N |
| SMILES | COc1ccc(C(C)=NNC(=O)c2ccncc2)cc1 |
|
~%
4-Pyridinecarbo... CAS#:793-05-5 |
| Literature: Sah; Peoples Journal of the American Pharmaceutical Association (1912-1977), 1954 , vol. 43, p. 513,514 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Methoxyacetophenon-isonicotinoylhydrazon |
| Isonicotinic acid |
| 4-Pyridinecarboxylicacid |
| 4-Methoxy-acetophenon-isonicotinoylhydrazon |