Benzenesulfonic acid, 2,3,4,5,6-pentafluoro-, phenyl ester structure
|
Common Name | Benzenesulfonic acid, 2,3,4,5,6-pentafluoro-, phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 793-75-9 | Molecular Weight | 324.22300 | |
| Density | 1.588g/cm3 | Boiling Point | 362ºC at 760mmHg | |
| Molecular Formula | C12H5F5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.7ºC | |
| Name | phenyl 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.588g/cm3 |
|---|---|
| Boiling Point | 362ºC at 760mmHg |
| Molecular Formula | C12H5F5O3S |
| Molecular Weight | 324.22300 |
| Flash Point | 172.7ºC |
| Exact Mass | 323.98800 |
| PSA | 51.75000 |
| LogP | 4.23060 |
| Index of Refraction | 1.525 |
| InChIKey | KRZWVPZFIQDBNN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
|
~93%
Benzenesulfonic... CAS#:793-75-9 |
| Literature: Horner, Leopold; Schmitt, Rolf-Erhard Phosphorus and Sulfur and the Related Elements, 1982 , vol. 13, p. 189 - 212 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Pentafluorophenylsulfonyloxybenzene |
| pentafluorbenzolsulfonsaeure-phenylester |
| phenyl pentafluorobenzenesulfonate |