N-[(tert-butylamino)-methylphosphoryl]-2-methylpropan-2-amine structure
|
Common Name | N-[(tert-butylamino)-methylphosphoryl]-2-methylpropan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 79371-01-0 | Molecular Weight | 206.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H23N2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(tert-butylamino)-methylphosphoryl]-2-methylpropan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H23N2OP |
|---|---|
| Molecular Weight | 206.26500 |
| Exact Mass | 206.15500 |
| PSA | 50.94000 |
| LogP | 3.36730 |
| InChIKey | RTKAXGMSAGQFBJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NP(C)(=O)NC(C)(C)C |
|
~%
N-[(tert-butyla... CAS#:79371-01-0 |
| Literature: Harger, Martin J. P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2127 - 2131 |
|
~%
N-[(tert-butyla... CAS#:79371-01-0 |
| Literature: Harger, Martin J. P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2127 - 2131 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N'-di-t-butyl-P-methylphosphonic diamide |
| N,N'-Di-tert-butyl-P-methylphosphonyldiamid |
| Phosphonic diamide,N,N'-bis(1,1-dimethylethyl)-P-methyl |