1H-Isoindole-1,3(2H)-dione,2-[2-(4-bromophenyl)-2-oxoethyl]- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-[2-(4-bromophenyl)-2-oxoethyl]- | ||
|---|---|---|---|---|
| CAS Number | 794-43-4 | Molecular Weight | 344.15900 | |
| Density | 1.595g/cm3 | Boiling Point | 502.6ºC at 760 mmHg | |
| Molecular Formula | C16H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.8ºC | |
| Name | 2-[2-(4-bromophenyl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.595g/cm3 |
|---|---|
| Boiling Point | 502.6ºC at 760 mmHg |
| Molecular Formula | C16H10BrNO3 |
| Molecular Weight | 344.15900 |
| Flash Point | 257.8ºC |
| Exact Mass | 342.98400 |
| PSA | 54.45000 |
| LogP | 2.86590 |
| Index of Refraction | 1.659 |
| InChIKey | PFNWVLUFYSPONA-UHFFFAOYSA-N |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)c1ccc(Br)cc1 |
|
~76%
1H-Isoindole-1,... CAS#:794-43-4 |
| Literature: Perez, Daniel I.; Palomo, Valle; Perez, Concepcion; Gil, Carmen; Dans, Pablo D.; Luque, F. Javier; Conde, Santiago; Martinez, Ana Journal of Medicinal Chemistry, 2011 , vol. 54, # 12 p. 4042 - 4056 |
|
~%
1H-Isoindole-1,... CAS#:794-43-4 |
| Literature: Lei, Aiwen; Wu, Shulin; He, Minsheng; Zhang, Xumu Journal of the American Chemical Society, 2004 , vol. 126, # 6 p. 1626 - 1627 |
|
~%
1H-Isoindole-1,... CAS#:794-43-4 |
| Literature: Wang, You-Qing; Lu, Sheng-Mei; Zhou, Yong-Gui Organic Letters, 2005 , vol. 7, # 15 p. 3235 - 3238 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-phthalimido-1-(4-bromo-phenyl)-ethanone |
| N-(4-Brom-phenacyl)-phthalimid |
| 1h-isoindole-1,3(2h)-dione,2-[2-(4-bromophenyl)-2-oxoethyl] |
| 2-(2-(4-bromophenyl)-2-oxoethyl)isoindoline-1,3-dione |
| N-(4'-bromobenzoyl)methylphthalimide |
| N-[2-(4-bromo-phenyl)-2-oxo-ethyl]-phthalimide |
| 1-phthalimido-2-(4-bromophenyl)-2-ethanone |
| 2-[2-(4-bromophenyl)-2-oxoethyl]-1H-isoindole-1,3(2H)-dione |
| N-(4-bromo-phenacyl)-phthalimide |