4,5-DIHYDRO-4,4-DIMETHYL-2-P-TOLYLOXAZOLE
4,5-DIHYDRO-4,4-DIMETHYL-2-P-TOLYLOXAZOLE structure
|
Common Name | 4,5-DIHYDRO-4,4-DIMETHYL-2-P-TOLYLOXAZOLE | ||
|---|---|---|---|---|
| CAS Number | 79568-30-2 | Molecular Weight | 189.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15NO |
|---|---|
| Molecular Weight | 189.25400 |
| Exact Mass | 189.11500 |
| PSA | 21.59000 |
| LogP | 1.98600 |
| InChIKey | LBKROYGEIXIACO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2=NC(C)(C)CO2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 1 | |
CAS#:3457-48-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(4-methylphenyl)-4,4-dimethyl-2-oxazoline |
| 4,4-dimethyl-2-(4-methylphenyl)-4,5-dihydro-1,3-oxazole |
| 4,4'-dimethyl-2-p-tolyl-2-oxazoline |
| 4,4-dimethyl-2-(4-tolyl)-1,3-oxazoline |
| Oxazole,4,5-dihydro-4,4-dimethyl-2-(4-methylphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 79568-30-2? |
| A: Chinese name of 79568-30-2 is 79568-30-2. |
| Q: What is the InChIKey of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole? |
| A: InChIKey of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole is LBKROYGEIXIACO-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole? |
| A: Polar surface area (PSA) of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole is 21.59000. |
| Q: What English synonyms does 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole have? |
| A: English synonyms of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole: 2-(4-methylphenyl)-4,4-dimethyl-2-oxazoline, 4,4-dimethyl-2-(4-methylphenyl)-4,5-dihydro-1,3-oxazole, 4,4'-dimethyl-2-p-tolyl-2-oxazoline, 4,4-dimethyl-2-(4-tolyl)-1,3-oxazoline, Oxazole,4,5-dihydro-4,4-dimethyl-2-(4-methylphenyl). |
| Q: What is the LogP of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole? |
| A: LogP of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole is 1.98600. |
| Q: What is the molecular weight of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole? |
| A: Molecular weight of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole is 189.25400. |
| Q: What is the SMILES notation of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole? |
| A: SMILES notation of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole is Cc1ccc(C2=NC(C)(C)CO2)cc1. |
| Q: What is the English name of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole? |
| A: The English name of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole is 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole. |
| Q: What is the CAS number of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole? |
| A: CAS number of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole is 79568-30-2. |
| Q: What is the molecular formula of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole? |
| A: Molecular formula of 4,4-dimethyl-2-(4-methylphenyl)-5H-1,3-oxazole is C12H15NO. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |