2'-Ethyl Simvastatin structure
|
Common Name | 2'-Ethyl Simvastatin | ||
|---|---|---|---|---|
| CAS Number | 79902-42-4 | Molecular Weight | 390.51300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-Ethyl Simvastatin2'-Ethyl Simvastatin (compound 6) is a Mevinolin analog, with HMG-CoA reductase inhibition[1]. |
| Name | <1S-<1α,3α,7β,8β(2S*,4S*)8aβ>>-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-8-<2-(tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl)ethyl>-1-naphthalenyl 2-methylpropionate |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-Ethyl Simvastatin (compound 6) is a Mevinolin analog, with HMG-CoA reductase inhibition[1]. |
|---|---|
| Related Catalog | |
| Target |
HMG-CoA reductase[1] |
| References |
| Molecular Formula | C23H34O5 |
|---|---|
| Molecular Weight | 390.51300 |
| Exact Mass | 390.24100 |
| PSA | 72.83000 |
| LogP | 3.80540 |
| InChIKey | KJXWSYMXRPCCCZ-INTXDZFKSA-N |
| SMILES | CC1C=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C2C(OC(=O)C(C)C)C1 |
| [1S-(1α,3α,7β,8β(2S*,4S*)8aβ)]-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-8-[2-(tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl)ethyl]-1-naphthalenyl 2-methylpropionate |
| zocor |
| Isobutyric acid (1S,3R,7S,8S,8aR)-8-[2-((2R,4R)-4-hydroxy-6-oxo-tetrahydro-pyran-2-yl)-ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydro-naphthalen-1-yl ester |