3-(4-methoxyanilino)-1,3-diphenylpropan-1-one
3-(4-methoxyanilino)-1,3-diphenylpropan-1-one structure
|
Common Name | 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 802-49-3 | Molecular Weight | 331.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one (CAS number: 802-49-3, molecular formula: C22H21NO2, molecular weight: 331.40800), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H21NO2 |
|---|---|
| Molecular Weight | 331.40800 |
| Exact Mass | 331.15700 |
| PSA | 38.33000 |
| LogP | 5.19440 |
| InChIKey | RSHMLORPKHFOAZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(CC(=O)c2ccccc2)c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:100-52-7
CAS#:104-94-9
CAS#:98-86-2
CAS#:94-41-7
CAS#:13735-81-4
CAS#:614-47-1
CAS#:783-08-4
CAS#:106-49-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-diphenyl-3-(p-methoxyphenylamino)-1-propanone |
| 3-(4-Methoxyanilino)-1,3-diphenyl-1-propanone |
| 3-(4-methoxy-phenylamino)-1,3-diphenyl-propan-1-one |
| 1,3-diphenyl-3-(N-4-methoxyphenyl)amino-1-propanone |
| 3-(p-methoxyphenylamino)-1,3-diphenyl-propan-1-one |
| 3-[N-(4-methoxyphenylamino)]-1,3-diphenyl-1-propanone |
| 3-(4-methoxyphenylamino)-1,3-diphenyl-1-propanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one? |
| A: LogP of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one is 5.19440. |
| Q: What is the molecular formula of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one? |
| A: Molecular formula of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one is C22H21NO2. |
| Q: What is the English name of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one? |
| A: The English name of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one is 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one. |
| Q: What is the molecular weight of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one? |
| A: Molecular weight of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one is 331.40800. |
| Q: What is the CAS number of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one? |
| A: CAS number of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one is 802-49-3. |
| Q: What is the Chinese name of 802-49-3? |
| A: Chinese name of 802-49-3 is 802-49-3. |
| Q: What are the upstream materials of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one? |
| A: Related upstream materials(CAS) of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one: 100-52-7;104-94-9;98-86-2;94-41-7;13735-81-4;614-47-1;783-08-4;106-49-0. |
| Q: What is the InChIKey of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one? |
| A: InChIKey of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one is RSHMLORPKHFOAZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one? |
| A: SMILES notation of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one is COc1ccc(NC(CC(=O)c2ccccc2)c2ccccc2)cc1. |
| Q: What English synonyms does 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one have? |
| A: English synonyms of 3-(4-methoxyanilino)-1,3-diphenylpropan-1-one: 1,3-diphenyl-3-(p-methoxyphenylamino)-1-propanone, 3-(4-Methoxyanilino)-1,3-diphenyl-1-propanone, 3-(4-methoxy-phenylamino)-1,3-diphenyl-propan-1-one, 1,3-diphenyl-3-(N-4-methoxyphenyl)amino-1-propanone, 3-(p-methoxyphenylamino)-1,3-diphenyl-propan-1-one, 3-[N-(4-methoxyphenylamino)]-1,3-diphenyl-1-propanone, 3-(4-methoxyphenylamino)-1,3-diphenyl-1-propanone. |