Artemisinic acid structure
|
Common Name | Artemisinic acid | ||
|---|---|---|---|---|
| CAS Number | 80286-58-4 | Molecular Weight | 234.334 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 373.6±11.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O2 | Melting Point | 129-131℃ | |
| MSDS | N/A | Flash Point | 273.3±10.2 °C | |
Use of Artemisinic acidArtemisinic acid (Qing Hao acid), an amorphane sesquiterpene isolated from Artemisia annua L., possesses a variety of pharmacological activity, such as antimalarial activity, anti-tumor activity, antipyretic effect, antibacterial activity, allelopathy effect and anti-adipogenesis effect[1]. |
| Name | (+)-artemisinic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Artemisinic acid (Qing Hao acid), an amorphane sesquiterpene isolated from Artemisia annua L., possesses a variety of pharmacological activity, such as antimalarial activity, anti-tumor activity, antipyretic effect, antibacterial activity, allelopathy effect and anti-adipogenesis effect[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 373.6±11.0 °C at 760 mmHg |
| Melting Point | 129-131℃ |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.334 |
| Flash Point | 273.3±10.2 °C |
| Exact Mass | 234.161987 |
| PSA | 37.30000 |
| LogP | 5.11 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | PLQMEXSCSAIXGB-SAXRGWBVSA-N |
| SMILES | C=C(C(=O)O)C1CCC(C)C2CCC(C)=CC12 |
| Storage condition | 2-8C |
|
~98%
Artemisinic acid CAS#:80286-58-4 |
| Literature: Amyris Biotechnologies Patent: US2006/270863 A1, 2006 ; Location in patent: Page/Page column 19 ; |
|
~%
Artemisinic acid CAS#:80286-58-4 |
| Literature: WO2009/85068 A1, ; Page/Page column 32-34 ; |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
|
Name: Cytotoxicity against mouse EAC at >175 uM after 3 days by MTT assay
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL1021029
|
|
Name: Cytotoxicity against mouse EAC after 3 days by MTT assay
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL1021027
|
| 2-[(1R,4R,4aS,8aR)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoic acid |
| ARTEMISINIC ACID |
| Artemisic acid |
| Qing Hau acid |
| artemisininic acid |
| arteannuic acid |
| Qing Hao acid |