Tenacigenin B structure
|
Common Name | Tenacigenin B | ||
|---|---|---|---|---|
| CAS Number | 80508-42-5 | Molecular Weight | 364.48 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 537.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H32O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.2±23.6 °C | |
Use of Tenacigenin BTenacigenin B is a steroid that can be isolated from the genus Alocasia. Tenacigenin B has anti-tumor effects on lymphoma via regulation of Aurora-A[1][2]. |
| Name | (3β,5α,11α,12β,14β,17α)-3,11,12-Trihydroxy-8,14-epoxypregnan-20-o ne |
|---|---|
| Synonym | More Synonyms |
| Description | Tenacigenin B is a steroid that can be isolated from the genus Alocasia. Tenacigenin B has anti-tumor effects on lymphoma via regulation of Aurora-A[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 537.2±50.0 °C at 760 mmHg |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 |
| Flash Point | 187.2±23.6 °C |
| Exact Mass | 364.224976 |
| PSA | 90.29000 |
| LogP | 1.50 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | FWXVLSDGEDMLQU-UYLIPJATSA-N |
| SMILES | CC(=O)C1CCC23OC24CCC2CC(O)CCC2(C)C4C(O)C(O)C13C |
| Hazard Codes | Xi |
|---|
| (3β,5α,11α,12β,14β,17α)-3,11,12-Trihydroxy-8,14-epoxypregnan-20-one |
| Pregnan-20-one, 8,14-epoxy-3,11,12-trihydroxy-, (3β,5α,11α,12β,14β,17α)- |