Kanamycin
Modify Date: 2025-08-21 12:22:22
Kanamycin structure
|
Common Name | Kanamycin | ||
|---|---|---|---|---|
| CAS Number | 8063-07-8 | Molecular Weight | 484.499 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 809.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C18H36N4O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 443.4±34.3 °C | |
| Name | kanamycin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 809.5±65.0 °C at 760 mmHg |
| Molecular Formula | C18H36N4O11 |
| Molecular Weight | 484.499 |
| Flash Point | 443.4±34.3 °C |
| Exact Mass | 484.238068 |
| PSA | 282.61000 |
| LogP | -2.58 |
| Vapour Pressure | 0.0±6.5 mmHg at 25°C |
| Index of Refraction | 1.670 |
| InChIKey | OGTKIXVMLDAMNU-KNQICTBBSA-N |
| SMILES | NCC1OC(OC2C(N)CC(N)C(OC3OC(CO)C(O)C(N)C3O)C2O)C(O)C(O)C1O.O=S(=O)(O)O.O=S(=O)(O)O |
| Storage condition | 2-8°C |
| Stability | Stability Incompatible with strong oxidizing agents. |
| Hazard Codes | T |
|---|---|
| Risk Phrases | R61 |
| Safety Phrases | 36/37/39-45-53 |
| WGK Germany | 2 |
| HS Code | 2941902000 |
| HS Code | 2941902000 |
|---|
| Kanaqua |
| Cristalomicina |
| Kanamycin A |
| KLEBCIL |
| O-3-Amino-3-deoxy-a-D-glucopyranosyl-(1®6)-O-[6-amino-6-deoxy-a-D-glucopyranosyl-(1®4)]-2-deoxy-D-streptamine |
| Kanamytrex |
| Kanacedin |
| (1S,2R,3R,4S,6R)-4,6-diamino-3-[(6-amino-6-deoxy-a-D-glucopyranosyl)oxy]-2-hydroxycyclohexyl 3-amino-3-deoxy-a-D-glucopyranoside |
| Kanescin |
| Cantrex |
| Kanicin |
| Otokalixin |
| Kanatrol |
| KANO |
| Kantrex |
| a-D-glucopyranoside, (1S,2R,3R,4S,6R)-4,6-diamino-3-[(6-amino-6-deoxy-a-D-glucopyranosyl)oxy]-2-hydroxycyclohexyl 3-amino-3-deoxy- |
| (1S,2R,3R,4S,6R)-4,6-Diamino-3-[(6-amino-6-deoxy-α-D-glucopyranosyl)oxy]-2-hydroxycyclohexyl 3-amino-3-deoxy-α-D-glucopyranoside |
| Kanabristol |
| Kannasyn |
| Kanasig |
| α-D-Glucopyranoside, (1S,2R,3R,4S,6R)-4,6-diamino-3-[(6-amino-6-deoxy-α-D-glucopyranosyl)oxy]-2-hydroxycyclohexyl 3-amino-3-deoxy- |