2H-1,3,5-Thiadiazine-2,4(3H)-dione,6-phenyl- structure
|
Common Name | 2H-1,3,5-Thiadiazine-2,4(3H)-dione,6-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 80784-80-1 | Molecular Weight | 206.22100 | |
| Density | 1.48g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H6N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-phenyl-1,3,5-thiadiazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Molecular Formula | C9H6N2O2S |
| Molecular Weight | 206.22100 |
| Exact Mass | 206.01500 |
| PSA | 91.06000 |
| LogP | 0.85860 |
| Index of Refraction | 1.714 |
| InChIKey | PRUASRFCAJECMS-UHFFFAOYSA-N |
| SMILES | O=c1nc(-c2ccccc2)sc(=O)[nH]1 |
|
~91%
2H-1,3,5-Thiadi... CAS#:80784-80-1 |
| Literature: Coburn; Ho; Bronstein Journal of Medicinal Chemistry, 1982 , vol. 25, # 4 p. 481 - 483 |
|
~%
2H-1,3,5-Thiadi... CAS#:80784-80-1 |
| Literature: Coburn; Ho; Bronstein Journal of Medicinal Chemistry, 1982 , vol. 25, # 4 p. 481 - 483 |
| 2-Phenyl-5,6-dihydro-1,3,5-thiadiazine-4,6-dione |