7-Oxo Cholesterol 3-Acetate structure
|
Common Name | 7-Oxo Cholesterol 3-Acetate | ||
|---|---|---|---|---|
| CAS Number | 809-51-8 | Molecular Weight | 442.67400 | |
| Density | 1.03g/cm3 | Boiling Point | 526.9ºC at 760 mmHg | |
| Molecular Formula | C29H46O3 | Melting Point | 157-158 °C | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 7-Oxocholesteryl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 526.9ºC at 760 mmHg |
| Melting Point | 157-158 °C |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.67400 |
| Flash Point | 220.9ºC |
| Exact Mass | 442.34500 |
| PSA | 43.37000 |
| LogP | 7.13850 |
| Index of Refraction | 1.52 |
| InChIKey | PMBSWZWCNKVWLV-OLVLZXMISA-N |
| SMILES | CC(=O)OC1CCC2(C)C(=CC(=O)C3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| Storage condition | 2-8°C |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
|
Name: Antitubercular activity against Mycobacterium tuberculosis H37Rv by MABA assay
Source: ChEMBL
Target: Mycobacterium tuberculosis
External Id: CHEMBL2445697
|
|
Name: Inhibition of sodium fluorescein uptake in OATP1B1-transfected CHO cells at an equimo...
Source: ChEMBL
Target: Solute carrier organic anion transporter family member 1B1
External Id: CHEMBL3039488
|
|
Name: Cytotoxicity against african green monkey Vero cells by tetrazolium dye reduction ass...
Source: ChEMBL
Target: Vero
External Id: CHEMBL2445696
|
|
Name: ERK5 transcriptional activity HTS
Source: 24565
Target: N/A
External Id: ERK5 transcriptional activity-HTS
|
|
Name: Inhibition of sodium fluorescein uptake in OATP1B3-transfected CHO cells at an equimo...
Source: ChEMBL
Target: Solute carrier organic anion transporter family member 1B3
External Id: CHEMBL3039491
|
|
Name: Human Phosphogluconate dehydrogenase (6PGD) Inhibitor Screening
Source: 11827
Target: Phosphogluconate dehydrogenase
External Id: 6PGD_Inhibitor_Screening_2015_09
|
| 7-Oxo Cholesterol 3-Acetate |
| 7-ketocholesterol acetate |
| 7-Oxocholesterol acetate |
| 7-Ketocholesteryl Acetate |
| 7-oxo-cholesteryl acetate |