9,10-Anthracenedione,2-chloro-1,4-dihydroxy structure
|
Common Name | 9,10-Anthracenedione,2-chloro-1,4-dihydroxy | ||
|---|---|---|---|---|
| CAS Number | 81-53-8 | Molecular Weight | 274.65600 | |
| Density | 1.636g/cm3 | Boiling Point | 489.2ºC at 760 mmHg | |
| Molecular Formula | C14H7ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.7ºC | |
| Name | 2-chloro-1,4-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.636g/cm3 |
|---|---|
| Boiling Point | 489.2ºC at 760 mmHg |
| Molecular Formula | C14H7ClO4 |
| Molecular Weight | 274.65600 |
| Flash Point | 249.7ºC |
| Exact Mass | 274.00300 |
| PSA | 74.60000 |
| LogP | 2.52660 |
| Index of Refraction | 1.734 |
| InChIKey | UJCPMVFRZRPROL-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(Cl)cc(O)c21 |
| Hazard Codes | Xn:Harmful |
|---|---|
| Safety Phrases | S36/37 |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-Chlor-1,4-dihydroxy-anthrachinon |
| Quinizarin,2-chloro |
| 2-chloro-1,4-dihydroxy-9,10-anthraquinone |
| 2-CHLORO QUINIZARIN |
| 2-chloro-1,4-dihydroxy-anthraquinone |
| 9,2-chloro-1,4-dihydroxy |