N-1-Naphthylglutamine hydrate (1:1)
Modify Date: 2025-08-22 13:54:17
N-1-Naphthylglutamine hydrate (1:1) structure
|
Common Name | N-1-Naphthylglutamine hydrate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 81012-91-1 | Molecular Weight | 290.314 | |
| Density | 1.329g/cm3 | Boiling Point | 589.1ºC at 760 mmHg | |
| Molecular Formula | C15H18N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 310.1ºC | |
| Symbol |
GHS08 |
Signal Word | Warning | |
| Name | N-(γ-L-GLUTAMYL)-α-NAPHTHYLAMIDE MONOHYDRATE |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 589.1ºC at 760 mmHg |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.314 |
| Flash Point | 310.1ºC |
| Exact Mass | 290.126648 |
| PSA | 101.65000 |
| LogP | 2.67940 |
| Index of Refraction | 1.679 |
| InChIKey | AYNVOYZIAJJNFE-ZOWNYOTGSA-N |
| SMILES | NC(CCC(=O)NC(=O)c1cccc2ccccc12)C(=O)O.O |
| Symbol |
GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H351 |
| Precautionary Statements | P281 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 40 |
| Safety Phrases | 22-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-1-Naphthylglutamine hydrate (1:1) |
| Glutamine, N-1-naphthalenyl-, hydrate (1:1) |
| MFCD00003879 |