2,4-diphenyl-5,6,7,8-tetrahydrochromenylium trifluoromethanesulphonate structure
|
Common Name | 2,4-diphenyl-5,6,7,8-tetrahydrochromenylium trifluoromethanesulphonate | ||
|---|---|---|---|---|
| CAS Number | 81128-01-0 | Molecular Weight | 436.44400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19F3O4S | Melting Point | 181-183 | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-diphenyl-5,6,7,8-tetrahydrochromen-1-ium,trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 181-183 |
|---|---|
| Molecular Formula | C22H19F3O4S |
| Molecular Weight | 436.44400 |
| Exact Mass | 436.09600 |
| PSA | 78.72000 |
| LogP | 6.90570 |
| InChIKey | LTJCXSMAZCZPIK-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(-c2cc(-c3ccccc3)c3c([o+]2)CCCC3)cc1 |
| Storage condition | Keep Cold |
|
~36%
2,4-diphenyl-5,... CAS#:81128-01-0 |
| Literature: Katritzky, Alan R.; Ueroegdi, Laszlo; Patel, Ranjan C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , p. 1349 - 1354 |
| MFCD00051892 |
| 2,4-DIBROMOPHENOL ACETATE |
| PC3055 |
| 2,4-diphenyl-5,6,7,8-tetrahydrochromylium triflate |
| 5,6,7,8-tetrahydro-2,4-diphenylchromenylium trifluoromethanesulphonate |
| 2,4-diphenyl-5,6,7,8-tetrahydrochromenylium trifluoromethanesulphonate |