2-(naphthalen-1-ylcarbamoyl)-6-nitro-benzoic acid
Modify Date: 2025-08-25 14:52:14
2-(naphthalen-1-ylcarbamoyl)-6-nitro-benzoic acid structure
|
Common Name | 2-(naphthalen-1-ylcarbamoyl)-6-nitro-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 81395-54-2 | Molecular Weight | 336.29800 | |
| Density | 1.482g/cm3 | Boiling Point | 509.5ºC at 760 mmHg | |
| Molecular Formula | C18H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262ºC | |
| Name | 2-(naphthalen-1-ylcarbamoyl)-6-nitrobenzoic acid |
|---|
| Density | 1.482g/cm3 |
|---|---|
| Boiling Point | 509.5ºC at 760 mmHg |
| Molecular Formula | C18H12N2O5 |
| Molecular Weight | 336.29800 |
| Flash Point | 262ºC |
| Exact Mass | 336.07500 |
| PSA | 112.22000 |
| LogP | 4.29470 |
| Index of Refraction | 1.747 |
| InChIKey | DNNHWRZBVXBAIU-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc2ccccc12)c1cccc([N+](=O)[O-])c1C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |