3-acetyl-5-methoxy-1,4-dihydronaphthoquinone structure
|
Common Name | 3-acetyl-5-methoxy-1,4-dihydronaphthoquinone | ||
|---|---|---|---|---|
| CAS Number | 81418-42-0 | Molecular Weight | 230.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-acetyl-5-methoxy-1,4-dihydronaphthoquinoneSARS-CoV MPro-IN-2 (compound 15) is a potent inhibitor of SARS-CoV-2 Mpro with an IC50 value of 72.07 nM. The main protease (Mpro) of the virus as the major enzyme processing viral polyproteins contributes to the replication and transcription of SARS-CoV-2 in host cells, and has been characterized as an attractive target in drug discovery. SARS-CoV MPro-IN-2 has the potential for the research of COVID-19[1]. |
| Name | 3-acetyl-5-methoxy-1,4-dihydronaphthoquinone |
|---|---|
| Synonym | More Synonyms |
| Description | SARS-CoV MPro-IN-2 (compound 15) is a potent inhibitor of SARS-CoV-2 Mpro with an IC50 value of 72.07 nM. The main protease (Mpro) of the virus as the major enzyme processing viral polyproteins contributes to the replication and transcription of SARS-CoV-2 in host cells, and has been characterized as an attractive target in drug discovery. SARS-CoV MPro-IN-2 has the potential for the research of COVID-19[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H10O4 |
|---|---|
| Molecular Weight | 230.21600 |
| Exact Mass | 230.05800 |
| PSA | 60.44000 |
| LogP | 1.58960 |
| InChIKey | QASXCIRROULNNX-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1C(=O)C(C(C)=O)=CC2=O |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| 3-Acetyl-5-methoxy-1,4-naphthoquinone |
| 3-acetyl-5-methoxy-1,4-naphthoquinone |
| 8-Methoxy-2-acetyl-naphthochinon-(1,4) |
| 2-acetyl-8-methoxy-1,4-naphthoquinone |