3-[3,5-Bis(trifluoromethyl)phenyl]-2-propyn-1-ol structure
|
Common Name | 3-[3,5-Bis(trifluoromethyl)phenyl]-2-propyn-1-ol | ||
|---|---|---|---|---|
| CAS Number | 81613-61-8 | Molecular Weight | 268.155 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 240.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H6F6O | Melting Point | 58 °C | |
| MSDS | N/A | Flash Point | 99.4±27.3 °C | |
| Name | 3-[3,5-bis(trifluoromethyl)phenyl]prop-2-yn-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 240.8±40.0 °C at 760 mmHg |
| Melting Point | 58 °C |
| Molecular Formula | C11H6F6O |
| Molecular Weight | 268.155 |
| Flash Point | 99.4±27.3 °C |
| Exact Mass | 268.032288 |
| PSA | 20.23000 |
| LogP | 3.75 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | UWJBHKXJMSHKKD-UHFFFAOYSA-N |
| SMILES | OCC#Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2906299090 |
|
~93%
3-[3,5-Bis(trif... CAS#:81613-61-8 |
| Literature: Feuerstein, Marie; Doucet, Henri; Santelli, Maurice Tetrahedron Letters, 2004 , vol. 45, # 8 p. 1603 - 1606 |
|
~%
3-[3,5-Bis(trif... CAS#:81613-61-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 41, # 7 p. 1084 - 1091 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| MFCD00052418 |
| 3-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]PROP-2-YN-1-OL |
| pc9022 |
| 2-Propyn-1-ol, 3-[3,5-bis(trifluoromethyl)phenyl]- |
| 3-[3,5-Bis(trifluoromethyl)phenyl]-2-propyn-1-ol |
| 3,5-Bis(trifluoro-methyl) phenyl propargyl alcohol |