Trichlorobenzene
Modify Date: 2025-11-28 16:44:43
Trichlorobenzene structure
|
Common Name | Trichlorobenzene | ||
|---|---|---|---|---|
| CAS Number | 818-26-8 | Molecular Weight | 270.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-oxohexadecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H30O3 |
|---|---|
| Molecular Weight | 270.40800 |
| Exact Mass | 270.21900 |
| PSA | 54.37000 |
| LogP | 4.73130 |
| InChIKey | VBFPQNKLKQDSCH-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)CCCCCCCCC(=O)O |
| Hazard Codes | Xi |
|---|
|
~%
Trichlorobenzene CAS#:818-26-8 |
| Literature: Fordyce; Johnson Journal of the American Chemical Society, 1933 , vol. 55, p. 3371 |
|
~%
Trichlorobenzene CAS#:818-26-8 |
| Literature: Fordyce; Johnson Journal of the American Chemical Society, 1933 , vol. 55, p. 3371 |
|
~%
Trichlorobenzene CAS#:818-26-8 |
| Literature: Fordyce; Johnson Journal of the American Chemical Society, 1933 , vol. 55, p. 3371 |
CAS#:57-11-4| 10-Oxo-palmitinsaeure |
| Hexadecanoic acid,10-oxo |
| 10-oxo-hexadecanoic acid |
| 10-keto palmitic acid |
| OHA |
| 10-Oxo-hexadecansaeure |