3,4-dibromobenzenesulfonyl chloride structure
|
Common Name | 3,4-dibromobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 81903-80-2 | Molecular Weight | 334.41300 | |
| Density | 2.11g/cm3 | Boiling Point | 346.9ºC at 760 mmHg | |
| Molecular Formula | C6H3Br2ClO2S | Melting Point | 34ºC | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | 3,4-dibromobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 2.11g/cm3 |
|---|---|
| Boiling Point | 346.9ºC at 760 mmHg |
| Melting Point | 34ºC |
| Molecular Formula | C6H3Br2ClO2S |
| Molecular Weight | 334.41300 |
| Flash Point | 163.6ºC |
| Exact Mass | 331.79100 |
| PSA | 42.52000 |
| LogP | 4.21990 |
| Index of Refraction | 1.622 |
| InChIKey | PBCQAUMKUSTMJD-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(Br)c(Br)c1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3261 |
| HS Code | 2904909090 |
|
~90%
3,4-dibromobenz... CAS#:81903-80-2 |
| Literature: Solov'eva, L. I.; Mikhalenko, S. A.; Chernykh, E. V.; Luk'yanets, E. A. J. Gen. Chem. USSR (Engl. Transl.), 1982 , vol. 52, # 1 p. 90 - 101,83 - 93 |
|
~%
3,4-dibromobenz... CAS#:81903-80-2 |
| Literature: Journal of the American Chemical Society, , vol. 62, p. 511,512 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,4-dibromophenylsulfonyl chloride |
| 3,4-dibromophenylsulfonic acid chloride |
| 3,4-Dibrom-benzolsulfonylchlorid |
| 3,4-dibromo-benzenesulfonyl chloride |
| Benzenesulfonylchloride,3,4-dibromo |