2,4-Dibromobenzenesulfonyl chloride structure
|
Common Name | 2,4-Dibromobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 72256-95-2 | Molecular Weight | 334.413 | |
| Density | 2.1±0.1 g/cm3 | Boiling Point | 338.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C6H3Br2ClO2S | Melting Point | 82-86 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 158.6±23.7 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2,4-Dibromobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 2.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.6±27.0 °C at 760 mmHg |
| Melting Point | 82-86 °C(lit.) |
| Molecular Formula | C6H3Br2ClO2S |
| Molecular Weight | 334.413 |
| Flash Point | 158.6±23.7 °C |
| Exact Mass | 331.790894 |
| PSA | 42.52000 |
| LogP | 3.51 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | OMOXIKAWVFDFNX-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(Br)cc1Br |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~%
2,4-Dibromobenz... CAS#:72256-95-2 |
| Literature: Journal of the American Chemical Society, , vol. 62, p. 511,512 |
|
~%
2,4-Dibromobenz... CAS#:72256-95-2 |
| Literature: Doklady Akademii Nauk SSSR, , vol. 112, p. 872,873 Doklady Chemistry, 112-117 <1957> 133, 134 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| WSGR BE DE |
| 2,4-Dibromobenzenesulphonyl chloride |
| Benzenesulfonyl chloride, 2,4-dibromo- |
| 2,4-Dibromobenzenesulfonyl chloride |
| MFCD03093759 |