1,8-diphenoxyanthraquinone structure
|
Common Name | 1,8-diphenoxyanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 82-17-7 | Molecular Weight | 392.40300 | |
| Density | 1.306g/cm3 | Boiling Point | 566.7ºC at 760 mmHg | |
| Molecular Formula | C26H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.2ºC | |
| Name | 1,8-diphenoxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 566.7ºC at 760 mmHg |
| Molecular Formula | C26H16O4 |
| Molecular Weight | 392.40300 |
| Flash Point | 247.2ºC |
| Exact Mass | 392.10500 |
| PSA | 52.60000 |
| LogP | 6.04660 |
| Index of Refraction | 1.665 |
| InChIKey | ADJYQFBOMQAMAI-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc(Oc3ccccc3)c2C(=O)c2c(Oc3ccccc3)cccc21 |
|
~%
1,8-diphenoxyan... CAS#:82-17-7 |
| Literature: Bayer and Co. Patent: DE158531 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 8, p. 241 |
|
~%
1,8-diphenoxyan... CAS#:82-17-7 |
| Literature: Bayer and Co Chem. Zentralbl., 1905 , vol. 76, # I p. 1517 Full Text Show Details Bayer and Co. Patent: DE158531 ; |
| 1,8-diphenoxy-anthraquinone |
| 1,8-Diphenoxy-anthrachinon |
| EINECS 201-399-6 |
| HMS553F05 |